About methyl-pentyl-triphenyl-λ5-phosphane tetrafluoroborate
methyl-pentyl-triphenyl-λ5-phosphane tetrafluoroborate (PubChem CID 174530893) has the molecular formula C24H29BF4P-
and a molecular weight of 435.27 g/mol. Its IUPAC name is methyl-pentyl-triphenyl-λ5-phosphane tetrafluoroborate.
Molecular Properties
| Compound Name | methyl-pentyl-triphenyl-λ5-phosphane tetrafluoroborate |
| PubChem CID | 174530893 |
| Molecular Formula | C24H29BF4P- |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | methyl-pentyl-triphenyl-λ5-phosphane tetrafluoroborate |
| SMILES | CCCCCP(C)(c1ccccc1)(c1ccccc1)c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C24H29P.BF4/c1-3-4-14-21-25(2,22-15-8-5-9-16-22,23-17-10-6-11-18-23)24-19-12-7-13-20-24;2-1(3,4)5/h5-13,15-20H,3-4,14,21H2,1-2H3;/q;-1 |
| InChIKey | WVSJNJZVGGDPON-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl-pentyl-triphenyl-λ5-phosphane tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl-pentyl-triphenyl-λ5-phosphane tetrafluoroborate?
The IUPAC name of methyl-pentyl-triphenyl-λ5-phosphane tetrafluoroborate (CID 174530893) is methyl-pentyl-triphenyl-λ5-phosphane tetrafluoroborate.
What is the SMILES notation for methyl-pentyl-triphenyl-λ5-phosphane tetrafluoroborate?
The canonical SMILES for methyl-pentyl-triphenyl-λ5-phosphane tetrafluoroborate is CCCCCP(C)(c1ccccc1)(c1ccccc1)c1ccccc1.F[B-](F)(F)F.
What is the InChIKey of methyl-pentyl-triphenyl-λ5-phosphane tetrafluoroborate?
The InChIKey is WVSJNJZVGGDPON-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29P.BF4/c1-3-4-14-21-25(2,22-15-8-5-9-16-22,23-17-10-6-11-18-23)24-19-12-7-13-20-24;2-1(3,4)5/h5-13,15-20H,3-4,14,21H2,1-2H3;/q;-1.
What are the key properties of methyl-pentyl-triphenyl-λ5-phosphane tetrafluoroborate?
methyl-pentyl-triphenyl-λ5-phosphane tetrafluoroborate has a molecular weight of 435.27 g/mol, XLogP of 6.64, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methyl-pentyl-triphenyl-λ5-phosphane tetrafluoroborate is sourced from PubChem (CID 174530893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).