About acetyl dodecanoate;azane
acetyl dodecanoate;azane (PubChem CID 174531393) has the molecular formula C14H29NO3
and a molecular weight of 259.39 g/mol. Its IUPAC name is acetyl dodecanoate;azane.
Molecular Properties
| Compound Name | acetyl dodecanoate;azane |
| PubChem CID | 174531393 |
| Molecular Formula | C14H29NO3 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | acetyl dodecanoate;azane |
| SMILES | CCCCCCCCCCCC(=O)OC(C)=O.N |
| InChI | InChI=1S/C14H26O3.H3N/c1-3-4-5-6-7-8-9-10-11-12-14(16)17-13(2)15;/h3-12H2,1-2H3;1H3 |
| InChIKey | YZNQLTBLKXBKSL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetyl dodecanoate;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl dodecanoate;azane?
The IUPAC name of acetyl dodecanoate;azane (CID 174531393) is acetyl dodecanoate;azane.
What is the SMILES notation for acetyl dodecanoate;azane?
The canonical SMILES for acetyl dodecanoate;azane is CCCCCCCCCCCC(=O)OC(C)=O.N.
What is the InChIKey of acetyl dodecanoate;azane?
The InChIKey is YZNQLTBLKXBKSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O3.H3N/c1-3-4-5-6-7-8-9-10-11-12-14(16)17-13(2)15;/h3-12H2,1-2H3;1H3.
What are the key properties of acetyl dodecanoate;azane?
acetyl dodecanoate;azane has a molecular weight of 259.39 g/mol, XLogP of 4.16, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl dodecanoate;azane is sourced from PubChem (CID 174531393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).