C25H25N3O6 — CID 174531506
butyl 19-ethyl-7,19-dihydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-10-carboximidate (PubChem CID 174531506) has the molecular formula C25H25N3O6 and a molecular weight of 463.49 g/mol. Its IUPAC name is butyl 19-ethyl-7,19-dihydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-10-carboximidate.
| Compound Name | butyl 19-ethyl-7,19-dihydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-10-carboximidate |
|---|---|
| PubChem CID | 174531506 |
| Molecular Formula | C25H25N3O6 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | butyl 19-ethyl-7,19-dihydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-10-carboximidate |
| SMILES | [H]/N=C(\OCCCC)c1c2c(nc3ccc(O)cc13)-c1cc3c(c(=O)n1C2)COC(=O)C3(O)CC |
| InChI | InChI=1S/C25H25N3O6/c1-3-5-8-33-22(26)20-14-9-13(29)6-7-18(14)27-21-15(20)11-28-19(21)10-17-16(23(28)30)12-34-24(31)25(17,32)4-2/h6-7,9-10,26,29,32H,3-5,8,11-12H2,1-2H3/b26-22- |
| InChIKey | NHWCAMMWLDTAOM-ROMGYVFFSA-N |
| XLogP | 2.93 |
| TPSA | 134.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|