About methyl 2-[1-[(2-amino-4,5-dichlorobenzoyl)amino]cyclohexyl]acetate
methyl 2-[1-[(2-amino-4,5-dichlorobenzoyl)amino]cyclohexyl]acetate (PubChem CID 174531828) has the molecular formula C16H20Cl2N2O3
and a molecular weight of 359.25 g/mol. Its IUPAC name is methyl 2-[1-[(2-amino-4,5-dichlorobenzoyl)amino]cyclohexyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[1-[(2-amino-4,5-dichlorobenzoyl)amino]cyclohexyl]acetate |
| PubChem CID | 174531828 |
| Molecular Formula | C16H20Cl2N2O3 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | methyl 2-[1-[(2-amino-4,5-dichlorobenzoyl)amino]cyclohexyl]acetate |
| SMILES | COC(=O)CC1(NC(=O)c2cc(Cl)c(Cl)cc2N)CCCCC1 |
| InChI | InChI=1S/C16H20Cl2N2O3/c1-23-14(21)9-16(5-3-2-4-6-16)20-15(22)10-7-11(17)12(18)8-13(10)19/h7-8H,2-6,9,19H2,1H3,(H,20,22) |
| InChIKey | PRYWSUDLHOTIIV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[1-[(2-amino-4,5-dichlorobenzoyl)amino]cyclohexyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-[(2-amino-4,5-dichlorobenzoyl)amino]cyclohexyl]acetate?
The IUPAC name of methyl 2-[1-[(2-amino-4,5-dichlorobenzoyl)amino]cyclohexyl]acetate (CID 174531828) is methyl 2-[1-[(2-amino-4,5-dichlorobenzoyl)amino]cyclohexyl]acetate.
What is the SMILES notation for methyl 2-[1-[(2-amino-4,5-dichlorobenzoyl)amino]cyclohexyl]acetate?
The canonical SMILES for methyl 2-[1-[(2-amino-4,5-dichlorobenzoyl)amino]cyclohexyl]acetate is COC(=O)CC1(NC(=O)c2cc(Cl)c(Cl)cc2N)CCCCC1.
What is the InChIKey of methyl 2-[1-[(2-amino-4,5-dichlorobenzoyl)amino]cyclohexyl]acetate?
The InChIKey is PRYWSUDLHOTIIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20Cl2N2O3/c1-23-14(21)9-16(5-3-2-4-6-16)20-15(22)10-7-11(17)12(18)8-13(10)19/h7-8H,2-6,9,19H2,1H3,(H,20,22).
What are the key properties of methyl 2-[1-[(2-amino-4,5-dichlorobenzoyl)amino]cyclohexyl]acetate?
methyl 2-[1-[(2-amino-4,5-dichlorobenzoyl)amino]cyclohexyl]acetate has a molecular weight of 359.25 g/mol, XLogP of 3.57, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-[(2-amino-4,5-dichlorobenzoyl)amino]cyclohexyl]acetate is sourced from PubChem (CID 174531828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).