C24H18N2O5 — CID 174532638
1-[[2-[4-(hydroxymethyl)phenyl]phenyl]carbamoyl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 174532638) has the molecular formula C24H18N2O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is 1-[[2-[4-(hydroxymethyl)phenyl]phenyl]carbamoyl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-[[2-[4-(hydroxymethyl)phenyl]phenyl]carbamoyl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 174532638 |
| Molecular Formula | C24H18N2O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-[[2-[4-(hydroxymethyl)phenyl]phenyl]carbamoyl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C(=O)Nc2ccccc2-c2ccc(CO)cc2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H18N2O5/c27-14-15-9-11-16(12-10-15)17-5-1-3-7-20(17)25-24(31)26-13-19(23(29)30)22(28)18-6-2-4-8-21(18)26/h1-13,27H,14H2,(H,25,31)(H,29,30) |
| InChIKey | JVDFFBQGLZYIBA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |