C23H26FN3O4 — CID 174532702
[(3S,6R)-4-[(2,6-dimethyl-4-nitrophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-3,6-dimethylpiperazin-2-ylidene]methanone (PubChem CID 174532702) has the molecular formula C23H26FN3O4 and a molecular weight of 427.48 g/mol. Its IUPAC name is [(3S,6R)-4-[(2,6-dimethyl-4-nitrophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-3,6-dimethylpiperazin-2-ylidene]methanone.
| Compound Name | [(3S,6R)-4-[(2,6-dimethyl-4-nitrophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-3,6-dimethylpiperazin-2-ylidene]methanone |
|---|---|
| PubChem CID | 174532702 |
| Molecular Formula | C23H26FN3O4 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | [(3S,6R)-4-[(2,6-dimethyl-4-nitrophenoxy)methyl]-1-[(4-fluorophenyl)methyl]-3,6-dimethylpiperazin-2-ylidene]methanone |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)c1OCN1C[C@@H](C)N(Cc2ccc(F)cc2)C(=C=O)[C@@H]1C |
| InChI | InChI=1S/C23H26FN3O4/c1-15-9-21(27(29)30)10-16(2)23(15)31-14-25-11-17(3)26(22(13-28)18(25)4)12-19-5-7-20(24)8-6-19/h5-10,17-18H,11-12,14H2,1-4H3/t17-,18+/m1/s1 |
| InChIKey | OFXWWPYKVIIYFG-MSOLQXFVSA-N |
| XLogP | 4.00 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|