About 4-methyl-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]benzene-1,3-dicarboxylic acid
4-methyl-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]benzene-1,3-dicarboxylic acid (PubChem CID 174532837) has the molecular formula C18H16N2O7
and a molecular weight of 372.33 g/mol. Its IUPAC name is 4-methyl-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]benzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-methyl-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]benzene-1,3-dicarboxylic acid |
| PubChem CID | 174532837 |
| Molecular Formula | C18H16N2O7 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 4-methyl-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1ccc(CNC(=O)c2c(C(=O)O)ccc(C)c2C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16N2O7/c1-9-3-5-11(7-13(9)20(26)27)8-19-16(21)15-12(17(22)23)6-4-10(2)14(15)18(24)25/h3-7H,8H2,1-2H3,(H,19,21)(H,22,23)(H,24,25) |
| InChIKey | FUQHJHKTGUXVFV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]benzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]benzene-1,3-dicarboxylic acid?
The IUPAC name of 4-methyl-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]benzene-1,3-dicarboxylic acid (CID 174532837) is 4-methyl-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]benzene-1,3-dicarboxylic acid.
What is the SMILES notation for 4-methyl-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]benzene-1,3-dicarboxylic acid?
The canonical SMILES for 4-methyl-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]benzene-1,3-dicarboxylic acid is Cc1ccc(CNC(=O)c2c(C(=O)O)ccc(C)c2C(=O)O)cc1[N+](=O)[O-].
What is the InChIKey of 4-methyl-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]benzene-1,3-dicarboxylic acid?
The InChIKey is FUQHJHKTGUXVFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O7/c1-9-3-5-11(7-13(9)20(26)27)8-19-16(21)15-12(17(22)23)6-4-10(2)14(15)18(24)25/h3-7H,8H2,1-2H3,(H,19,21)(H,22,23)(H,24,25).
What are the key properties of 4-methyl-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]benzene-1,3-dicarboxylic acid?
4-methyl-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]benzene-1,3-dicarboxylic acid has a molecular weight of 372.33 g/mol, XLogP of 2.54, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-[(4-methyl-3-nitrophenyl)methylcarbamoyl]benzene-1,3-dicarboxylic acid is sourced from PubChem (CID 174532837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).