C55H54N8O5 — CID 174533107
(1R,5R)-1,5-dihydroxy-2,4-bis[4-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]piperazin-1-yl]-1,5-diphenylpentan-3-one (PubChem CID 174533107) has the molecular formula C55H54N8O5 and a molecular weight of 907.09 g/mol. Its IUPAC name is (1R,5R)-1,5-dihydroxy-2,4-bis[4-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]piperazin-1-yl]-1,5-diphenylpentan-3-one.
| Compound Name | (1R,5R)-1,5-dihydroxy-2,4-bis[4-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]piperazin-1-yl]-1,5-diphenylpentan-3-one |
|---|---|
| PubChem CID | 174533107 |
| Molecular Formula | C55H54N8O5 |
| Molecular Weight | 907.09 g/mol |
| Exact Mass | 906.42 |
| IUPAC Name | (1R,5R)-1,5-dihydroxy-2,4-bis[4-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]piperazin-1-yl]-1,5-diphenylpentan-3-one |
| SMILES | Cc1ccc2c(N3CCN(C(C(=O)C([C@H](O)c4ccccc4)N4CCN(c5nc(-c6ccccc6O)nc6cc(C)ccc56)CC4)[C@H](O)c4ccccc4)CC3)nc(-c3ccccc3O)nc2c1 |
| InChI | InChI=1S/C55H54N8O5/c1-35-21-23-39-43(33-35)56-52(41-17-9-11-19-45(41)64)58-54(39)62-29-25-60(26-30-62)47(49(66)37-13-5-3-6-14-37)51(68)48(50(67)38-15-7-4-8-16-38)61-27-31-63(32-28-61)55-40-24-22-36(2)34-44(40)57-53(59-55)42-18-10-12-20-46(42)65/h3-24,33-34,47-50,64-67H,25-32H2,1-2H3/t47?,48?,49-,50-/m1/s1 |
| InChIKey | LZOBMWFBPMRTFR-PWYGQJPCSA-N |
| XLogP | 7.65 |
| TPSA | 162.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.09 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |