C13H19NO6S — CID 174533441
2-[ethyl(sulfanyl)amino]acetic acid;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 174533441) has the molecular formula C13H19NO6S and a molecular weight of 317.36 g/mol. Its IUPAC name is 2-[ethyl(sulfanyl)amino]acetic acid;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | 2-[ethyl(sulfanyl)amino]acetic acid;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174533441 |
| Molecular Formula | C13H19NO6S |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 2-[ethyl(sulfanyl)amino]acetic acid;1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.CCN(S)CC(=O)O |
| InChI | InChI=1S/C9H10O4.C4H9NO2S/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-2-5(8)3-4(6)7/h2-4H,5H2,1H3,(H,10,11)(H,12,13);8H,2-3H2,1H3,(H,6,7) |
| InChIKey | URSJCWZJKOSZRD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|