C20H19Cl2NO — CID 174533706
[1-(4-chlorophenyl)cyclopropyl]-[4-(4-chlorophenyl)pyrrolidin-2-yl]methanone (PubChem CID 174533706) has the molecular formula C20H19Cl2NO and a molecular weight of 360.28 g/mol. Its IUPAC name is [1-(4-chlorophenyl)cyclopropyl]-[4-(4-chlorophenyl)pyrrolidin-2-yl]methanone.
| Compound Name | [1-(4-chlorophenyl)cyclopropyl]-[4-(4-chlorophenyl)pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 174533706 |
| Molecular Formula | C20H19Cl2NO |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | [1-(4-chlorophenyl)cyclopropyl]-[4-(4-chlorophenyl)pyrrolidin-2-yl]methanone |
| SMILES | O=C(C1CC(c2ccc(Cl)cc2)CN1)C1(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H19Cl2NO/c21-16-5-1-13(2-6-16)14-11-18(23-12-14)19(24)20(9-10-20)15-3-7-17(22)8-4-15/h1-8,14,18,23H,9-12H2 |
| InChIKey | FZUZAEIBGMRJKS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |