About 2-chlorohexadecan-5-one
2-chlorohexadecan-5-one (PubChem CID 174534085) has the molecular formula C16H31ClO
and a molecular weight of 274.88 g/mol. Its IUPAC name is 2-chlorohexadecan-5-one.
Molecular Properties
| Compound Name | 2-chlorohexadecan-5-one |
| PubChem CID | 174534085 |
| Molecular Formula | C16H31ClO |
| Molecular Weight | 274.88 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | 2-chlorohexadecan-5-one |
| SMILES | CCCCCCCCCCCC(=O)CCC(C)Cl |
| InChI | InChI=1S/C16H31ClO/c1-3-4-5-6-7-8-9-10-11-12-16(18)14-13-15(2)17/h15H,3-14H2,1-2H3 |
| InChIKey | ZRPHCOBXFSJJPS-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.88 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorohexadecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorohexadecan-5-one?
The IUPAC name of 2-chlorohexadecan-5-one (CID 174534085) is 2-chlorohexadecan-5-one.
What is the SMILES notation for 2-chlorohexadecan-5-one?
The canonical SMILES for 2-chlorohexadecan-5-one is CCCCCCCCCCCC(=O)CCC(C)Cl.
What is the InChIKey of 2-chlorohexadecan-5-one?
The InChIKey is ZRPHCOBXFSJJPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31ClO/c1-3-4-5-6-7-8-9-10-11-12-16(18)14-13-15(2)17/h15H,3-14H2,1-2H3.
What are the key properties of 2-chlorohexadecan-5-one?
2-chlorohexadecan-5-one has a molecular weight of 274.88 g/mol, XLogP of 5.88, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorohexadecan-5-one is sourced from PubChem (CID 174534085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).