C11H15N3 — CID 174534127
N,N-diethyl-1H-indazol-3-amine (PubChem CID 174534127) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is N,N-diethyl-1H-indazol-3-amine.
| Compound Name | N,N-diethyl-1H-indazol-3-amine |
|---|---|
| PubChem CID | 174534127 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | N,N-diethyl-1H-indazol-3-amine |
| SMILES | CCN(CC)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C11H15N3/c1-3-14(4-2)11-9-7-5-6-8-10(9)12-13-11/h5-8H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | OLNGYBDMEIIAQJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |