C23H24N4O3 — CID 174534854
3-[[[4-(quinolin-3-ylmethyl)piperazine-1-carbonyl]amino]methyl]benzoic acid (PubChem CID 174534854) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is 3-[[[4-(quinolin-3-ylmethyl)piperazine-1-carbonyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[4-(quinolin-3-ylmethyl)piperazine-1-carbonyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 174534854 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 3-[[[4-(quinolin-3-ylmethyl)piperazine-1-carbonyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNC(=O)N2CCN(Cc3cnc4ccccc4c3)CC2)c1 |
| InChI | InChI=1S/C23H24N4O3/c28-22(29)20-6-3-4-17(12-20)14-25-23(30)27-10-8-26(9-11-27)16-18-13-19-5-1-2-7-21(19)24-15-18/h1-7,12-13,15H,8-11,14,16H2,(H,25,30)(H,28,29) |
| InChIKey | VJLKUHJCQCGWFU-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |