About 3,5-diacetyl-1H-pyrimidine-2,4-dione
3,5-diacetyl-1H-pyrimidine-2,4-dione (PubChem CID 174535800) has the molecular formula C8H8N2O4
and a molecular weight of 196.16 g/mol. Its IUPAC name is 3,5-diacetyl-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3,5-diacetyl-1H-pyrimidine-2,4-dione |
| PubChem CID | 174535800 |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 3,5-diacetyl-1H-pyrimidine-2,4-dione |
| SMILES | CC(=O)c1c[nH]c(=O)n(C(C)=O)c1=O |
| InChI | InChI=1S/C8H8N2O4/c1-4(11)6-3-9-8(14)10(5(2)12)7(6)13/h3H,1-2H3,(H,9,14) |
| InChIKey | JLNAIPDNJJGUHT-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-diacetyl-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diacetyl-1H-pyrimidine-2,4-dione?
The IUPAC name of 3,5-diacetyl-1H-pyrimidine-2,4-dione (CID 174535800) is 3,5-diacetyl-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 3,5-diacetyl-1H-pyrimidine-2,4-dione?
The canonical SMILES for 3,5-diacetyl-1H-pyrimidine-2,4-dione is CC(=O)c1c[nH]c(=O)n(C(C)=O)c1=O.
What is the InChIKey of 3,5-diacetyl-1H-pyrimidine-2,4-dione?
The InChIKey is JLNAIPDNJJGUHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O4/c1-4(11)6-3-9-8(14)10(5(2)12)7(6)13/h3H,1-2H3,(H,9,14).
What are the key properties of 3,5-diacetyl-1H-pyrimidine-2,4-dione?
3,5-diacetyl-1H-pyrimidine-2,4-dione has a molecular weight of 196.16 g/mol, XLogP of -0.60, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diacetyl-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 174535800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).