C15H15N2O4S- — CID 174536908
[3-oxo-2-phenoxy-3-(2-sulfinatohydrazinyl)propyl]benzene (PubChem CID 174536908) has the molecular formula C15H15N2O4S- and a molecular weight of 319.36 g/mol. Its IUPAC name is [3-oxo-2-phenoxy-3-(2-sulfinatohydrazinyl)propyl]benzene.
| Compound Name | [3-oxo-2-phenoxy-3-(2-sulfinatohydrazinyl)propyl]benzene |
|---|---|
| PubChem CID | 174536908 |
| Molecular Formula | C15H15N2O4S- |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | [3-oxo-2-phenoxy-3-(2-sulfinatohydrazinyl)propyl]benzene |
| SMILES | O=C(NNS(=O)[O-])C(Cc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C15H16N2O4S/c18-15(16-17-22(19)20)14(11-12-7-3-1-4-8-12)21-13-9-5-2-6-10-13/h1-10,14,17H,11H2,(H,16,18)(H,19,20)/p-1 |
| InChIKey | NXTZWNLZBZJZDG-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|