C11H16FeO — CID 174537314
iron(2+);methanone;1,2,3,4,5-pentamethylcyclopenta-1,3-diene (PubChem CID 174537314) has the molecular formula C11H16FeO and a molecular weight of 220.09 g/mol. Its IUPAC name is iron(2+);methanone;1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
| Compound Name | iron(2+);methanone;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 174537314 |
| Molecular Formula | C11H16FeO |
| Molecular Weight | 220.09 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | iron(2+);methanone;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[CH-]=O.[Fe+2] |
| InChI | InChI=1S/C10H15.CHO.Fe/c1-6-7(2)9(4)10(5)8(6)3;1-2;/h1-5H3;1H;/q2*-1;+2 |
| InChIKey | GEXHEGZCWYNSHZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.09 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|