About (2,2-dimethylchromen-6-yl) 3-methylbutanoate
(2,2-dimethylchromen-6-yl) 3-methylbutanoate (PubChem CID 174537350) has the molecular formula C16H20O3
and a molecular weight of 260.33 g/mol. Its IUPAC name is (2,2-dimethylchromen-6-yl) 3-methylbutanoate.
Molecular Properties
| Compound Name | (2,2-dimethylchromen-6-yl) 3-methylbutanoate |
| PubChem CID | 174537350 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2,2-dimethylchromen-6-yl) 3-methylbutanoate |
| SMILES | CC(C)CC(=O)Oc1ccc2c(c1)C=CC(C)(C)O2 |
| InChI | InChI=1S/C16H20O3/c1-11(2)9-15(17)18-13-5-6-14-12(10-13)7-8-16(3,4)19-14/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | FAPZKAGIXRMDLO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethylchromen-6-yl) 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethylchromen-6-yl) 3-methylbutanoate?
The IUPAC name of (2,2-dimethylchromen-6-yl) 3-methylbutanoate (CID 174537350) is (2,2-dimethylchromen-6-yl) 3-methylbutanoate.
What is the SMILES notation for (2,2-dimethylchromen-6-yl) 3-methylbutanoate?
The canonical SMILES for (2,2-dimethylchromen-6-yl) 3-methylbutanoate is CC(C)CC(=O)Oc1ccc2c(c1)C=CC(C)(C)O2.
What is the InChIKey of (2,2-dimethylchromen-6-yl) 3-methylbutanoate?
The InChIKey is FAPZKAGIXRMDLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O3/c1-11(2)9-15(17)18-13-5-6-14-12(10-13)7-8-16(3,4)19-14/h5-8,10-11H,9H2,1-4H3.
What are the key properties of (2,2-dimethylchromen-6-yl) 3-methylbutanoate?
(2,2-dimethylchromen-6-yl) 3-methylbutanoate has a molecular weight of 260.33 g/mol, XLogP of 3.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethylchromen-6-yl) 3-methylbutanoate is sourced from PubChem (CID 174537350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).