C14H21F3O2 — CID 174537537
2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylmethyl)-3,3,3-trifluoro-2-hydroxypropanal (PubChem CID 174537537) has the molecular formula C14H21F3O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylmethyl)-3,3,3-trifluoro-2-hydroxypropanal.
| Compound Name | 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylmethyl)-3,3,3-trifluoro-2-hydroxypropanal |
|---|---|
| PubChem CID | 174537537 |
| Molecular Formula | C14H21F3O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ylmethyl)-3,3,3-trifluoro-2-hydroxypropanal |
| SMILES | O=CC(O)(CC1CCCC2CCCCC21)C(F)(F)F |
| InChI | InChI=1S/C14H21F3O2/c15-14(16,17)13(19,9-18)8-11-6-3-5-10-4-1-2-7-12(10)11/h9-12,19H,1-8H2 |
| InChIKey | QVMFMIRQQGYATI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|