About [2-(azidomethyl)phenyl] 2-methylpropanoate
[2-(azidomethyl)phenyl] 2-methylpropanoate (PubChem CID 174537569) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is [2-(azidomethyl)phenyl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [2-(azidomethyl)phenyl] 2-methylpropanoate |
| PubChem CID | 174537569 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | [2-(azidomethyl)phenyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1ccccc1CN=[N+]=[N-] |
| InChI | InChI=1S/C11H13N3O2/c1-8(2)11(15)16-10-6-4-3-5-9(10)7-13-14-12/h3-6,8H,7H2,1-2H3 |
| InChIKey | LQPPFRXZRHCWGG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [2-(azidomethyl)phenyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(azidomethyl)phenyl] 2-methylpropanoate?
The IUPAC name of [2-(azidomethyl)phenyl] 2-methylpropanoate (CID 174537569) is [2-(azidomethyl)phenyl] 2-methylpropanoate.
What is the SMILES notation for [2-(azidomethyl)phenyl] 2-methylpropanoate?
The canonical SMILES for [2-(azidomethyl)phenyl] 2-methylpropanoate is CC(C)C(=O)Oc1ccccc1CN=[N+]=[N-].
What is the InChIKey of [2-(azidomethyl)phenyl] 2-methylpropanoate?
The InChIKey is LQPPFRXZRHCWGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c1-8(2)11(15)16-10-6-4-3-5-9(10)7-13-14-12/h3-6,8H,7H2,1-2H3.
What are the key properties of [2-(azidomethyl)phenyl] 2-methylpropanoate?
[2-(azidomethyl)phenyl] 2-methylpropanoate has a molecular weight of 219.24 g/mol, XLogP of 3.06, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(azidomethyl)phenyl] 2-methylpropanoate is sourced from PubChem (CID 174537569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).