About 6-(azidomethyl)bicyclo[3.1.0]hexa-1(6),2,4-triene
6-(azidomethyl)bicyclo[3.1.0]hexa-1(6),2,4-triene (PubChem CID 174537571) has the molecular formula C7H5N3
and a molecular weight of 131.14 g/mol. Its IUPAC name is 6-(azidomethyl)bicyclo[3.1.0]hexa-1(6),2,4-triene.
Molecular Properties
| Compound Name | 6-(azidomethyl)bicyclo[3.1.0]hexa-1(6),2,4-triene |
| PubChem CID | 174537571 |
| Molecular Formula | C7H5N3 |
| Molecular Weight | 131.14 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | 6-(azidomethyl)bicyclo[3.1.0]hexa-1(6),2,4-triene |
| SMILES | [N-]=[N+]=NCc1c2cccc1-2 |
| InChI | InChI=1S/C7H5N3/c8-10-9-4-7-5-2-1-3-6(5)7/h1-3H,4H2 |
| InChIKey | SRKLJMKPKKKLJS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.14 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 6-(azidomethyl)bicyclo[3.1.0]hexa-1(6),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(azidomethyl)bicyclo[3.1.0]hexa-1(6),2,4-triene?
The IUPAC name of 6-(azidomethyl)bicyclo[3.1.0]hexa-1(6),2,4-triene (CID 174537571) is 6-(azidomethyl)bicyclo[3.1.0]hexa-1(6),2,4-triene.
What is the SMILES notation for 6-(azidomethyl)bicyclo[3.1.0]hexa-1(6),2,4-triene?
The canonical SMILES for 6-(azidomethyl)bicyclo[3.1.0]hexa-1(6),2,4-triene is [N-]=[N+]=NCc1c2cccc1-2.
What is the InChIKey of 6-(azidomethyl)bicyclo[3.1.0]hexa-1(6),2,4-triene?
The InChIKey is SRKLJMKPKKKLJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3/c8-10-9-4-7-5-2-1-3-6(5)7/h1-3H,4H2.
What are the key properties of 6-(azidomethyl)bicyclo[3.1.0]hexa-1(6),2,4-triene?
6-(azidomethyl)bicyclo[3.1.0]hexa-1(6),2,4-triene has a molecular weight of 131.14 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(azidomethyl)bicyclo[3.1.0]hexa-1(6),2,4-triene is sourced from PubChem (CID 174537571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).