C11H8F3NO2 — CID 174537633
3-(2-aminoethynyl)-4-(2,2,2-trifluoroethyl)benzoic acid (PubChem CID 174537633) has the molecular formula C11H8F3NO2 and a molecular weight of 243.18 g/mol. Its IUPAC name is 3-(2-aminoethynyl)-4-(2,2,2-trifluoroethyl)benzoic acid.
| Compound Name | 3-(2-aminoethynyl)-4-(2,2,2-trifluoroethyl)benzoic acid |
|---|---|
| PubChem CID | 174537633 |
| Molecular Formula | C11H8F3NO2 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 3-(2-aminoethynyl)-4-(2,2,2-trifluoroethyl)benzoic acid |
| SMILES | NC#Cc1cc(C(=O)O)ccc1CC(F)(F)F |
| InChI | InChI=1S/C11H8F3NO2/c12-11(13,14)6-9-2-1-8(10(16)17)5-7(9)3-4-15/h1-2,5H,6,15H2,(H,16,17) |
| InChIKey | SCQOSWCRCOZSGK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|