About diphenylphosphane;bis(1H-naphthalen-1-ide);palladium(2+)
diphenylphosphane;bis(1H-naphthalen-1-ide);palladium(2+) (PubChem CID 174537984) has the molecular formula C32H25PPd
and a molecular weight of 546.95 g/mol. Its IUPAC name is diphenylphosphane;bis(1H-naphthalen-1-ide);palladium(2+).
Molecular Properties
| Compound Name | diphenylphosphane;bis(1H-naphthalen-1-ide);palladium(2+) |
| PubChem CID | 174537984 |
| Molecular Formula | C32H25PPd |
| Molecular Weight | 546.95 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | diphenylphosphane;bis(1H-naphthalen-1-ide);palladium(2+) |
| SMILES | [Pd+2].[c-]1cccc2ccccc12.[c-]1cccc2ccccc12.c1ccc(Pc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11P.2C10H7.Pd/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2*1-2-6-10-8-4-3-7-9(10)5-1;/h1-10,13H;2*1-7H;/q;2*-1;+2 |
| InChIKey | OSIMYRCCDZBOOS-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 546.95 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphane;bis(1H-naphthalen-1-ide);palladium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphane;bis(1H-naphthalen-1-ide);palladium(2+)?
The IUPAC name of diphenylphosphane;bis(1H-naphthalen-1-ide);palladium(2+) (CID 174537984) is diphenylphosphane;bis(1H-naphthalen-1-ide);palladium(2+).
What is the SMILES notation for diphenylphosphane;bis(1H-naphthalen-1-ide);palladium(2+)?
The canonical SMILES for diphenylphosphane;bis(1H-naphthalen-1-ide);palladium(2+) is [Pd+2].[c-]1cccc2ccccc12.[c-]1cccc2ccccc12.c1ccc(Pc2ccccc2)cc1.
What is the InChIKey of diphenylphosphane;bis(1H-naphthalen-1-ide);palladium(2+)?
The InChIKey is OSIMYRCCDZBOOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11P.2C10H7.Pd/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;2*1-2-6-10-8-4-3-7-9(10)5-1;/h1-10,13H;2*1-7H;/q;2*-1;+2.
What are the key properties of diphenylphosphane;bis(1H-naphthalen-1-ide);palladium(2+)?
diphenylphosphane;bis(1H-naphthalen-1-ide);palladium(2+) has a molecular weight of 546.95 g/mol, XLogP of 7.59, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphane;bis(1H-naphthalen-1-ide);palladium(2+) is sourced from PubChem (CID 174537984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).