About 6,6-dichloro-2-phenylcyclohexa-2,4-dien-1-amine;hydrochloride
6,6-dichloro-2-phenylcyclohexa-2,4-dien-1-amine;hydrochloride (PubChem CID 174538534) has the molecular formula C12H12Cl3N
and a molecular weight of 276.59 g/mol. Its IUPAC name is 6,6-dichloro-2-phenylcyclohexa-2,4-dien-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 6,6-dichloro-2-phenylcyclohexa-2,4-dien-1-amine;hydrochloride |
| PubChem CID | 174538534 |
| Molecular Formula | C12H12Cl3N |
| Molecular Weight | 276.59 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 6,6-dichloro-2-phenylcyclohexa-2,4-dien-1-amine;hydrochloride |
| SMILES | Cl.NC1C(c2ccccc2)=CC=CC1(Cl)Cl |
| InChI | InChI=1S/C12H11Cl2N.ClH/c13-12(14)8-4-7-10(11(12)15)9-5-2-1-3-6-9;/h1-8,11H,15H2;1H |
| InChIKey | MTPZVKZQGMABLF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dichloro-2-phenylcyclohexa-2,4-dien-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dichloro-2-phenylcyclohexa-2,4-dien-1-amine;hydrochloride?
The IUPAC name of 6,6-dichloro-2-phenylcyclohexa-2,4-dien-1-amine;hydrochloride (CID 174538534) is 6,6-dichloro-2-phenylcyclohexa-2,4-dien-1-amine;hydrochloride.
What is the SMILES notation for 6,6-dichloro-2-phenylcyclohexa-2,4-dien-1-amine;hydrochloride?
The canonical SMILES for 6,6-dichloro-2-phenylcyclohexa-2,4-dien-1-amine;hydrochloride is Cl.NC1C(c2ccccc2)=CC=CC1(Cl)Cl.
What is the InChIKey of 6,6-dichloro-2-phenylcyclohexa-2,4-dien-1-amine;hydrochloride?
The InChIKey is MTPZVKZQGMABLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2N.ClH/c13-12(14)8-4-7-10(11(12)15)9-5-2-1-3-6-9;/h1-8,11H,15H2;1H.
What are the key properties of 6,6-dichloro-2-phenylcyclohexa-2,4-dien-1-amine;hydrochloride?
6,6-dichloro-2-phenylcyclohexa-2,4-dien-1-amine;hydrochloride has a molecular weight of 276.59 g/mol, XLogP of 3.56, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dichloro-2-phenylcyclohexa-2,4-dien-1-amine;hydrochloride is sourced from PubChem (CID 174538534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).