About 1-methyl-5-sulfanylimidazolidine-2,4-dione;propane
1-methyl-5-sulfanylimidazolidine-2,4-dione;propane (PubChem CID 174538671) has the molecular formula C7H14N2O2S
and a molecular weight of 190.27 g/mol. Its IUPAC name is 1-methyl-5-sulfanylimidazolidine-2,4-dione;propane.
Molecular Properties
| Compound Name | 1-methyl-5-sulfanylimidazolidine-2,4-dione;propane |
| PubChem CID | 174538671 |
| Molecular Formula | C7H14N2O2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 1-methyl-5-sulfanylimidazolidine-2,4-dione;propane |
| SMILES | CCC.CN1C(=O)NC(=O)C1S |
| InChI | InChI=1S/C4H6N2O2S.C3H8/c1-6-3(9)2(7)5-4(6)8;1-3-2/h3,9H,1H3,(H,5,7,8);3H2,1-2H3 |
| InChIKey | NEEPQVVROANJPL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-5-sulfanylimidazolidine-2,4-dione;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-sulfanylimidazolidine-2,4-dione;propane?
The IUPAC name of 1-methyl-5-sulfanylimidazolidine-2,4-dione;propane (CID 174538671) is 1-methyl-5-sulfanylimidazolidine-2,4-dione;propane.
What is the SMILES notation for 1-methyl-5-sulfanylimidazolidine-2,4-dione;propane?
The canonical SMILES for 1-methyl-5-sulfanylimidazolidine-2,4-dione;propane is CCC.CN1C(=O)NC(=O)C1S.
What is the InChIKey of 1-methyl-5-sulfanylimidazolidine-2,4-dione;propane?
The InChIKey is NEEPQVVROANJPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2S.C3H8/c1-6-3(9)2(7)5-4(6)8;1-3-2/h3,9H,1H3,(H,5,7,8);3H2,1-2H3.
What are the key properties of 1-methyl-5-sulfanylimidazolidine-2,4-dione;propane?
1-methyl-5-sulfanylimidazolidine-2,4-dione;propane has a molecular weight of 190.27 g/mol, XLogP of 0.84, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-sulfanylimidazolidine-2,4-dione;propane is sourced from PubChem (CID 174538671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).