N-methylcyclopentanamine;2,2,2-trifluoroacetic acid

C8H14F3NO2 — CID 174539018

IUPACN-methylcyclopentanamine;2,2,2-trifluoroacetic acid
SMILESCNC1CCCC1.O=C(O)C(F)(F)F
InChIInChI=1S/C6H13N.C2HF3O2/c1-7-6-4-2-3-5-6;3-2(4,5)1(6)7/h6-7H,2-5H2,1H3;(H,6,7)
InChIKeyUSROYCANUSPBPU-UHFFFAOYSA-N
MW213.20 g/mol
LogP1.78
Rot. Bonds1

About N-methylcyclopentanamine;2,2,2-trifluoroacetic acid

N-methylcyclopentanamine;2,2,2-trifluoroacetic acid (PubChem CID 174539018) has the molecular formula C8H14F3NO2 and a molecular weight of 213.20 g/mol. Its IUPAC name is N-methylcyclopentanamine;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound NameN-methylcyclopentanamine;2,2,2-trifluoroacetic acid
PubChem CID174539018
Molecular FormulaC8H14F3NO2
Molecular Weight213.20 g/mol
Exact Mass213.10
IUPAC NameN-methylcyclopentanamine;2,2,2-trifluoroacetic acid
SMILESCNC1CCCC1.O=C(O)C(F)(F)F
InChIInChI=1S/C6H13N.C2HF3O2/c1-7-6-4-2-3-5-6;3-2(4,5)1(6)7/h6-7H,2-5H2,1H3;(H,6,7)
InChIKeyUSROYCANUSPBPU-UHFFFAOYSA-N
XLogP1.78
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.20
LogP ≤ 51.78
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze N-methylcyclopentanamine;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-methylcyclopentanamine;2,2,2-trifluoroacetic acid?
The IUPAC name of N-methylcyclopentanamine;2,2,2-trifluoroacetic acid (CID 174539018) is N-methylcyclopentanamine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for N-methylcyclopentanamine;2,2,2-trifluoroacetic acid?
The canonical SMILES for N-methylcyclopentanamine;2,2,2-trifluoroacetic acid is CNC1CCCC1.O=C(O)C(F)(F)F.
What is the InChIKey of N-methylcyclopentanamine;2,2,2-trifluoroacetic acid?
The InChIKey is USROYCANUSPBPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C2HF3O2/c1-7-6-4-2-3-5-6;3-2(4,5)1(6)7/h6-7H,2-5H2,1H3;(H,6,7).
What are the key properties of N-methylcyclopentanamine;2,2,2-trifluoroacetic acid?
N-methylcyclopentanamine;2,2,2-trifluoroacetic acid has a molecular weight of 213.20 g/mol, XLogP of 1.78, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylcyclopentanamine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 174539018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).