C18H19NO — CID 174540012
2-benzyl-3,3-dimethyl-1H-isoindole-1-carbaldehyde (PubChem CID 174540012) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-benzyl-3,3-dimethyl-1H-isoindole-1-carbaldehyde.
| Compound Name | 2-benzyl-3,3-dimethyl-1H-isoindole-1-carbaldehyde |
|---|---|
| PubChem CID | 174540012 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-benzyl-3,3-dimethyl-1H-isoindole-1-carbaldehyde |
| SMILES | CC1(C)c2ccccc2C(C=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO/c1-18(2)16-11-7-6-10-15(16)17(13-20)19(18)12-14-8-4-3-5-9-14/h3-11,13,17H,12H2,1-2H3 |
| InChIKey | LWCWQCGLVAFCFK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|