About 1-[(5,5-dimethyl-2-phenyl-1,3-dioxan-2-yl)methylsulfanyl]ethyl acetate
1-[(5,5-dimethyl-2-phenyl-1,3-dioxan-2-yl)methylsulfanyl]ethyl acetate (PubChem CID 174540258) has the molecular formula C17H24O4S
and a molecular weight of 324.44 g/mol. Its IUPAC name is 1-[(5,5-dimethyl-2-phenyl-1,3-dioxan-2-yl)methylsulfanyl]ethyl acetate.
Molecular Properties
| Compound Name | 1-[(5,5-dimethyl-2-phenyl-1,3-dioxan-2-yl)methylsulfanyl]ethyl acetate |
| PubChem CID | 174540258 |
| Molecular Formula | C17H24O4S |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-[(5,5-dimethyl-2-phenyl-1,3-dioxan-2-yl)methylsulfanyl]ethyl acetate |
| SMILES | CC(=O)OC(C)SCC1(c2ccccc2)OCC(C)(C)CO1 |
| InChI | InChI=1S/C17H24O4S/c1-13(18)21-14(2)22-12-17(15-8-6-5-7-9-15)19-10-16(3,4)11-20-17/h5-9,14H,10-12H2,1-4H3 |
| InChIKey | HMHRQMQNBCJOMQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-[(5,5-dimethyl-2-phenyl-1,3-dioxan-2-yl)methylsulfanyl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5,5-dimethyl-2-phenyl-1,3-dioxan-2-yl)methylsulfanyl]ethyl acetate?
The IUPAC name of 1-[(5,5-dimethyl-2-phenyl-1,3-dioxan-2-yl)methylsulfanyl]ethyl acetate (CID 174540258) is 1-[(5,5-dimethyl-2-phenyl-1,3-dioxan-2-yl)methylsulfanyl]ethyl acetate.
What is the SMILES notation for 1-[(5,5-dimethyl-2-phenyl-1,3-dioxan-2-yl)methylsulfanyl]ethyl acetate?
The canonical SMILES for 1-[(5,5-dimethyl-2-phenyl-1,3-dioxan-2-yl)methylsulfanyl]ethyl acetate is CC(=O)OC(C)SCC1(c2ccccc2)OCC(C)(C)CO1.
What is the InChIKey of 1-[(5,5-dimethyl-2-phenyl-1,3-dioxan-2-yl)methylsulfanyl]ethyl acetate?
The InChIKey is HMHRQMQNBCJOMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O4S/c1-13(18)21-14(2)22-12-17(15-8-6-5-7-9-15)19-10-16(3,4)11-20-17/h5-9,14H,10-12H2,1-4H3.
What are the key properties of 1-[(5,5-dimethyl-2-phenyl-1,3-dioxan-2-yl)methylsulfanyl]ethyl acetate?
1-[(5,5-dimethyl-2-phenyl-1,3-dioxan-2-yl)methylsulfanyl]ethyl acetate has a molecular weight of 324.44 g/mol, XLogP of 3.55, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5,5-dimethyl-2-phenyl-1,3-dioxan-2-yl)methylsulfanyl]ethyl acetate is sourced from PubChem (CID 174540258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).