C45H50O6P2 — CID 174541027
hydroxy-[3-[hydroxy-(2-methylphenoxy)-bis(2-methylphenyl)-λ5-phosphanyl]oxypropoxy]-(2-methylphenoxy)-bis(2-methylphenyl)-λ5-phosphane (PubChem CID 174541027) has the molecular formula C45H50O6P2 and a molecular weight of 748.84 g/mol. Its IUPAC name is hydroxy-[3-[hydroxy-(2-methylphenoxy)-bis(2-methylphenyl)-λ5-phosphanyl]oxypropoxy]-(2-methylphenoxy)-bis(2-methylphenyl)-λ5-phosphane.
| Compound Name | hydroxy-[3-[hydroxy-(2-methylphenoxy)-bis(2-methylphenyl)-λ5-phosphanyl]oxypropoxy]-(2-methylphenoxy)-bis(2-methylphenyl)-λ5-phosphane |
|---|---|
| PubChem CID | 174541027 |
| Molecular Formula | C45H50O6P2 |
| Molecular Weight | 748.84 g/mol |
| Exact Mass | 748.31 |
| IUPAC Name | hydroxy-[3-[hydroxy-(2-methylphenoxy)-bis(2-methylphenyl)-λ5-phosphanyl]oxypropoxy]-(2-methylphenoxy)-bis(2-methylphenyl)-λ5-phosphane |
| SMILES | Cc1ccccc1OP(O)(OCCCOP(O)(Oc1ccccc1C)(c1ccccc1C)c1ccccc1C)(c1ccccc1C)c1ccccc1C |
| InChI | InChI=1S/C45H50O6P2/c1-34-20-7-13-26-40(34)50-52(46,42-28-15-9-22-36(42)3,43-29-16-10-23-37(43)4)48-32-19-33-49-53(47,44-30-17-11-24-38(44)5,45-31-18-12-25-39(45)6)51-41-27-14-8-21-35(41)2/h7-18,20-31,46-47H,19,32-33H2,1-6H3 |
| InChIKey | OYMKZAKKMMTQGA-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.84 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|