About 1-benzyl-4,4-dichloropyridine
1-benzyl-4,4-dichloropyridine (PubChem CID 174541492) has the molecular formula C12H11Cl2N
and a molecular weight of 240.13 g/mol. Its IUPAC name is 1-benzyl-4,4-dichloropyridine.
Molecular Properties
| Compound Name | 1-benzyl-4,4-dichloropyridine |
| PubChem CID | 174541492 |
| Molecular Formula | C12H11Cl2N |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 1-benzyl-4,4-dichloropyridine |
| SMILES | ClC1(Cl)C=CN(Cc2ccccc2)C=C1 |
| InChI | InChI=1S/C12H11Cl2N/c13-12(14)6-8-15(9-7-12)10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | KNEBQWABDYVPKS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4,4-dichloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4,4-dichloropyridine?
The IUPAC name of 1-benzyl-4,4-dichloropyridine (CID 174541492) is 1-benzyl-4,4-dichloropyridine.
What is the SMILES notation for 1-benzyl-4,4-dichloropyridine?
The canonical SMILES for 1-benzyl-4,4-dichloropyridine is ClC1(Cl)C=CN(Cc2ccccc2)C=C1.
What is the InChIKey of 1-benzyl-4,4-dichloropyridine?
The InChIKey is KNEBQWABDYVPKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl2N/c13-12(14)6-8-15(9-7-12)10-11-4-2-1-3-5-11/h1-9H,10H2.
What are the key properties of 1-benzyl-4,4-dichloropyridine?
1-benzyl-4,4-dichloropyridine has a molecular weight of 240.13 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4,4-dichloropyridine is sourced from PubChem (CID 174541492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).