C14H18N2O2 — CID 174541769
4-(2,3-dimethoxyphenyl)cyclohexa-2,4-diene-1,1-diamine (PubChem CID 174541769) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-(2,3-dimethoxyphenyl)cyclohexa-2,4-diene-1,1-diamine.
| Compound Name | 4-(2,3-dimethoxyphenyl)cyclohexa-2,4-diene-1,1-diamine |
|---|---|
| PubChem CID | 174541769 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 4-(2,3-dimethoxyphenyl)cyclohexa-2,4-diene-1,1-diamine |
| SMILES | COc1cccc(C2=CCC(N)(N)C=C2)c1OC |
| InChI | InChI=1S/C14H18N2O2/c1-17-12-5-3-4-11(13(12)18-2)10-6-8-14(15,16)9-7-10/h3-8H,9,15-16H2,1-2H3 |
| InChIKey | KAEYDCNEBMYBKO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|