About pent-3-en-2-ylideneurea
pent-3-en-2-ylideneurea (PubChem CID 174541910) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is pent-3-en-2-ylideneurea.
Molecular Properties
| Compound Name | pent-3-en-2-ylideneurea |
| PubChem CID | 174541910 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | pent-3-en-2-ylideneurea |
| SMILES | CC=CC(C)=NC(N)=O |
| InChI | InChI=1S/C6H10N2O/c1-3-4-5(2)8-6(7)9/h3-4H,1-2H3,(H2,7,9) |
| InChIKey | VNQMQHJIIALXPX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze pent-3-en-2-ylideneurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pent-3-en-2-ylideneurea?
The IUPAC name of pent-3-en-2-ylideneurea (CID 174541910) is pent-3-en-2-ylideneurea.
What is the SMILES notation for pent-3-en-2-ylideneurea?
The canonical SMILES for pent-3-en-2-ylideneurea is CC=CC(C)=NC(N)=O.
What is the InChIKey of pent-3-en-2-ylideneurea?
The InChIKey is VNQMQHJIIALXPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-3-4-5(2)8-6(7)9/h3-4H,1-2H3,(H2,7,9).
What are the key properties of pent-3-en-2-ylideneurea?
pent-3-en-2-ylideneurea has a molecular weight of 126.16 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pent-3-en-2-ylideneurea is sourced from PubChem (CID 174541910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).