About benzaldehyde;dimethyl hydrogen phosphate
benzaldehyde;dimethyl hydrogen phosphate (PubChem CID 174541999) has the molecular formula C9H13O5P
and a molecular weight of 232.17 g/mol. Its IUPAC name is benzaldehyde;dimethyl hydrogen phosphate.
Molecular Properties
| Compound Name | benzaldehyde;dimethyl hydrogen phosphate |
| PubChem CID | 174541999 |
| Molecular Formula | C9H13O5P |
| Molecular Weight | 232.17 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | benzaldehyde;dimethyl hydrogen phosphate |
| SMILES | COP(=O)(O)OC.O=Cc1ccccc1 |
| InChI | InChI=1S/C7H6O.C2H7O4P/c8-6-7-4-2-1-3-5-7;1-5-7(3,4)6-2/h1-6H;1-2H3,(H,3,4) |
| InChIKey | LSHHRWZXEZYAJA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.17 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;dimethyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;dimethyl hydrogen phosphate?
The IUPAC name of benzaldehyde;dimethyl hydrogen phosphate (CID 174541999) is benzaldehyde;dimethyl hydrogen phosphate.
What is the SMILES notation for benzaldehyde;dimethyl hydrogen phosphate?
The canonical SMILES for benzaldehyde;dimethyl hydrogen phosphate is COP(=O)(O)OC.O=Cc1ccccc1.
What is the InChIKey of benzaldehyde;dimethyl hydrogen phosphate?
The InChIKey is LSHHRWZXEZYAJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O.C2H7O4P/c8-6-7-4-2-1-3-5-7;1-5-7(3,4)6-2/h1-6H;1-2H3,(H,3,4).
What are the key properties of benzaldehyde;dimethyl hydrogen phosphate?
benzaldehyde;dimethyl hydrogen phosphate has a molecular weight of 232.17 g/mol, XLogP of 1.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;dimethyl hydrogen phosphate is sourced from PubChem (CID 174541999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).