About octane;sulfoformic acid
octane;sulfoformic acid (PubChem CID 174542033) has the molecular formula C9H20O5S
and a molecular weight of 240.32 g/mol. Its IUPAC name is octane;sulfoformic acid.
Molecular Properties
| Compound Name | octane;sulfoformic acid |
| PubChem CID | 174542033 |
| Molecular Formula | C9H20O5S |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | octane;sulfoformic acid |
| SMILES | CCCCCCCC.O=C(O)S(=O)(=O)O |
| InChI | InChI=1S/C8H18.CH2O5S/c1-3-5-7-8-6-4-2;2-1(3)7(4,5)6/h3-8H2,1-2H3;(H,2,3)(H,4,5,6) |
| InChIKey | NWSCNWZEEMGUEW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze octane;sulfoformic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octane;sulfoformic acid?
The IUPAC name of octane;sulfoformic acid (CID 174542033) is octane;sulfoformic acid.
What is the SMILES notation for octane;sulfoformic acid?
The canonical SMILES for octane;sulfoformic acid is CCCCCCCC.O=C(O)S(=O)(=O)O.
What is the InChIKey of octane;sulfoformic acid?
The InChIKey is NWSCNWZEEMGUEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.CH2O5S/c1-3-5-7-8-6-4-2;2-1(3)7(4,5)6/h3-8H2,1-2H3;(H,2,3)(H,4,5,6).
What are the key properties of octane;sulfoformic acid?
octane;sulfoformic acid has a molecular weight of 240.32 g/mol, XLogP of 2.92, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octane;sulfoformic acid is sourced from PubChem (CID 174542033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).