About benzamide;3-[(2-chloro-3-fluorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid
benzamide;3-[(2-chloro-3-fluorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid (PubChem CID 174542145) has the molecular formula C18H14ClFN4O4
and a molecular weight of 404.79 g/mol. Its IUPAC name is benzamide;3-[(2-chloro-3-fluorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid.
Molecular Properties
| Compound Name | benzamide;3-[(2-chloro-3-fluorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid |
| PubChem CID | 174542145 |
| Molecular Formula | C18H14ClFN4O4 |
| Molecular Weight | 404.79 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | benzamide;3-[(2-chloro-3-fluorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid |
| SMILES | NC(=O)c1ccccc1.O=C(O)c1cc(NC(=O)c2cccc(F)c2Cl)n[nH]1 |
| InChI | InChI=1S/C11H7ClFN3O3.C7H7NO/c12-9-5(2-1-3-6(9)13)10(17)14-8-4-7(11(18)19)15-16-8;8-7(9)6-4-2-1-3-5-6/h1-4H,(H,18,19)(H2,14,15,16,17);1-5H,(H2,8,9) |
| InChIKey | RXAXSRVAVBTNRU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 138.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.79 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzamide;3-[(2-chloro-3-fluorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;3-[(2-chloro-3-fluorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid?
The IUPAC name of benzamide;3-[(2-chloro-3-fluorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid (CID 174542145) is benzamide;3-[(2-chloro-3-fluorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for benzamide;3-[(2-chloro-3-fluorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid?
The canonical SMILES for benzamide;3-[(2-chloro-3-fluorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid is NC(=O)c1ccccc1.O=C(O)c1cc(NC(=O)c2cccc(F)c2Cl)n[nH]1.
What is the InChIKey of benzamide;3-[(2-chloro-3-fluorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid?
The InChIKey is RXAXSRVAVBTNRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClFN3O3.C7H7NO/c12-9-5(2-1-3-6(9)13)10(17)14-8-4-7(11(18)19)15-16-8;8-7(9)6-4-2-1-3-5-6/h1-4H,(H,18,19)(H2,14,15,16,17);1-5H,(H2,8,9).
What are the key properties of benzamide;3-[(2-chloro-3-fluorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid?
benzamide;3-[(2-chloro-3-fluorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid has a molecular weight of 404.79 g/mol, XLogP of 2.94, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;3-[(2-chloro-3-fluorobenzoyl)amino]-1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 174542145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).