C17H13F2N3O2 — CID 17454266
3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-4-ylpropanamide (PubChem CID 17454266) has the molecular formula C17H13F2N3O2 and a molecular weight of 329.31 g/mol. Its IUPAC name is 3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-4-ylpropanamide.
| Compound Name | 3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-4-ylpropanamide |
|---|---|
| PubChem CID | 17454266 |
| Molecular Formula | C17H13F2N3O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 3-[5-(2,6-difluorophenyl)-1,3-oxazol-2-yl]-N-pyridin-4-ylpropanamide |
| SMILES | O=C(CCc1ncc(-c2c(F)cccc2F)o1)Nc1ccncc1 |
| InChI | InChI=1S/C17H13F2N3O2/c18-12-2-1-3-13(19)17(12)14-10-21-16(24-14)5-4-15(23)22-11-6-8-20-9-7-11/h1-3,6-10H,4-5H2,(H,20,22,23) |
| InChIKey | TVDGZCWLFCFEFT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |