About benzo[e][1]benzofuran;N,N-dimethylmethanamine
benzo[e][1]benzofuran;N,N-dimethylmethanamine (PubChem CID 174542666) has the molecular formula C15H17NO
and a molecular weight of 227.31 g/mol. Its IUPAC name is benzo[e][1]benzofuran;N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | benzo[e][1]benzofuran;N,N-dimethylmethanamine |
| PubChem CID | 174542666 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | benzo[e][1]benzofuran;N,N-dimethylmethanamine |
| SMILES | CN(C)C.c1ccc2c(c1)ccc1occc12 |
| InChI | InChI=1S/C12H8O.C3H9N/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-12;1-4(2)3/h1-8H;1-3H3 |
| InChIKey | LZJMGSUMKYYHLL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzo[e][1]benzofuran;N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[e][1]benzofuran;N,N-dimethylmethanamine?
The IUPAC name of benzo[e][1]benzofuran;N,N-dimethylmethanamine (CID 174542666) is benzo[e][1]benzofuran;N,N-dimethylmethanamine.
What is the SMILES notation for benzo[e][1]benzofuran;N,N-dimethylmethanamine?
The canonical SMILES for benzo[e][1]benzofuran;N,N-dimethylmethanamine is CN(C)C.c1ccc2c(c1)ccc1occc12.
What is the InChIKey of benzo[e][1]benzofuran;N,N-dimethylmethanamine?
The InChIKey is LZJMGSUMKYYHLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O.C3H9N/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-12;1-4(2)3/h1-8H;1-3H3.
What are the key properties of benzo[e][1]benzofuran;N,N-dimethylmethanamine?
benzo[e][1]benzofuran;N,N-dimethylmethanamine has a molecular weight of 227.31 g/mol, XLogP of 3.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[e][1]benzofuran;N,N-dimethylmethanamine is sourced from PubChem (CID 174542666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).