About N,N-dimethylethanamine;5-imino-2,2-dimethylhexan-3-one
N,N-dimethylethanamine;5-imino-2,2-dimethylhexan-3-one (PubChem CID 174542988) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is N,N-dimethylethanamine;5-imino-2,2-dimethylhexan-3-one.
Molecular Properties
| Compound Name | N,N-dimethylethanamine;5-imino-2,2-dimethylhexan-3-one |
| PubChem CID | 174542988 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N,N-dimethylethanamine;5-imino-2,2-dimethylhexan-3-one |
| SMILES | CCN(C)C.[H]/N=C(\C)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C8H15NO.C4H11N/c1-6(9)5-7(10)8(2,3)4;1-4-5(2)3/h9H,5H2,1-4H3;4H2,1-3H3/b9-6+; |
| InChIKey | UBEZLZODURALFO-MLBSPLJJSA-N |
| XLogP | 2.60 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylethanamine;5-imino-2,2-dimethylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylethanamine;5-imino-2,2-dimethylhexan-3-one?
The IUPAC name of N,N-dimethylethanamine;5-imino-2,2-dimethylhexan-3-one (CID 174542988) is N,N-dimethylethanamine;5-imino-2,2-dimethylhexan-3-one.
What is the SMILES notation for N,N-dimethylethanamine;5-imino-2,2-dimethylhexan-3-one?
The canonical SMILES for N,N-dimethylethanamine;5-imino-2,2-dimethylhexan-3-one is CCN(C)C.[H]/N=C(\C)CC(=O)C(C)(C)C.
What is the InChIKey of N,N-dimethylethanamine;5-imino-2,2-dimethylhexan-3-one?
The InChIKey is UBEZLZODURALFO-MLBSPLJJSA-N. The full InChI is InChI=1S/C8H15NO.C4H11N/c1-6(9)5-7(10)8(2,3)4;1-4-5(2)3/h9H,5H2,1-4H3;4H2,1-3H3/b9-6+;.
What are the key properties of N,N-dimethylethanamine;5-imino-2,2-dimethylhexan-3-one?
N,N-dimethylethanamine;5-imino-2,2-dimethylhexan-3-one has a molecular weight of 214.35 g/mol, XLogP of 2.60, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylethanamine;5-imino-2,2-dimethylhexan-3-one is sourced from PubChem (CID 174542988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).