C14H26 — CID 174543750
3,3-dibutylcyclohexene (PubChem CID 174543750) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is 3,3-dibutylcyclohexene.
| Compound Name | 3,3-dibutylcyclohexene |
|---|---|
| PubChem CID | 174543750 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 3,3-dibutylcyclohexene |
| SMILES | CCCCC1(CCCC)C=CCCC1 |
| InChI | InChI=1S/C14H26/c1-3-5-10-14(11-6-4-2)12-8-7-9-13-14/h8,12H,3-7,9-11,13H2,1-2H3 |
| InChIKey | BKWHZTUCEXGGIQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|