About 2-(1H-inden-2-yl)furan;zirconium
2-(1H-inden-2-yl)furan;zirconium (PubChem CID 174544021) has the molecular formula C13H10OZr
and a molecular weight of 273.45 g/mol. Its IUPAC name is 2-(1H-inden-2-yl)furan;zirconium.
Molecular Properties
| Compound Name | 2-(1H-inden-2-yl)furan;zirconium |
| PubChem CID | 174544021 |
| Molecular Formula | C13H10OZr |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 2-(1H-inden-2-yl)furan;zirconium |
| SMILES | C1=C(c2ccco2)Cc2ccccc21.[Zr] |
| InChI | InChI=1S/C13H10O.Zr/c1-2-5-11-9-12(8-10(11)4-1)13-6-3-7-14-13;/h1-8H,9H2; |
| InChIKey | GEITYFLCGTWOQD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(1H-inden-2-yl)furan;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-inden-2-yl)furan;zirconium?
The IUPAC name of 2-(1H-inden-2-yl)furan;zirconium (CID 174544021) is 2-(1H-inden-2-yl)furan;zirconium.
What is the SMILES notation for 2-(1H-inden-2-yl)furan;zirconium?
The canonical SMILES for 2-(1H-inden-2-yl)furan;zirconium is C1=C(c2ccco2)Cc2ccccc21.[Zr].
What is the InChIKey of 2-(1H-inden-2-yl)furan;zirconium?
The InChIKey is GEITYFLCGTWOQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.Zr/c1-2-5-11-9-12(8-10(11)4-1)13-6-3-7-14-13;/h1-8H,9H2;.
What are the key properties of 2-(1H-inden-2-yl)furan;zirconium?
2-(1H-inden-2-yl)furan;zirconium has a molecular weight of 273.45 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-inden-2-yl)furan;zirconium is sourced from PubChem (CID 174544021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).