C19H16N2OS — CID 174544028
1-(11-methyl-13-phenyl-8-thia-5,10-diazatetracyclo[7.4.0.02,7.03,5]trideca-1(13),2(7),9,11-tetraen-12-yl)ethanone (PubChem CID 174544028) has the molecular formula C19H16N2OS and a molecular weight of 320.42 g/mol. Its IUPAC name is 1-(11-methyl-13-phenyl-8-thia-5,10-diazatetracyclo[7.4.0.02,7.03,5]trideca-1(13),2(7),9,11-tetraen-12-yl)ethanone.
| Compound Name | 1-(11-methyl-13-phenyl-8-thia-5,10-diazatetracyclo[7.4.0.02,7.03,5]trideca-1(13),2(7),9,11-tetraen-12-yl)ethanone |
|---|---|
| PubChem CID | 174544028 |
| Molecular Formula | C19H16N2OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-(11-methyl-13-phenyl-8-thia-5,10-diazatetracyclo[7.4.0.02,7.03,5]trideca-1(13),2(7),9,11-tetraen-12-yl)ethanone |
| SMILES | CC(=O)c1c(C)nc2sc3c(c2c1-c1ccccc1)C1CN1C3 |
| InChI | InChI=1S/C19H16N2OS/c1-10-15(11(2)22)16(12-6-4-3-5-7-12)18-17-13-8-21(13)9-14(17)23-19(18)20-10/h3-7,13H,8-9H2,1-2H3 |
| InChIKey | NNFNECUXFOZVTP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 32.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|