About N-(N'-ethylcarbamimidoyl)-3-phenylprop-2-enamide
N-(N'-ethylcarbamimidoyl)-3-phenylprop-2-enamide (PubChem CID 174544031) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is N-(N'-ethylcarbamimidoyl)-3-phenylprop-2-enamide.
Molecular Properties
| Compound Name | N-(N'-ethylcarbamimidoyl)-3-phenylprop-2-enamide |
| PubChem CID | 174544031 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | N-(N'-ethylcarbamimidoyl)-3-phenylprop-2-enamide |
| SMILES | CC/N=C(\N)NC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C12H15N3O/c1-2-14-12(13)15-11(16)9-8-10-6-4-3-5-7-10/h3-9H,2H2,1H3,(H3,13,14,15,16) |
| InChIKey | KARVUJDEPRSAFW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(N'-ethylcarbamimidoyl)-3-phenylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(N'-ethylcarbamimidoyl)-3-phenylprop-2-enamide?
The IUPAC name of N-(N'-ethylcarbamimidoyl)-3-phenylprop-2-enamide (CID 174544031) is N-(N'-ethylcarbamimidoyl)-3-phenylprop-2-enamide.
What is the SMILES notation for N-(N'-ethylcarbamimidoyl)-3-phenylprop-2-enamide?
The canonical SMILES for N-(N'-ethylcarbamimidoyl)-3-phenylprop-2-enamide is CC/N=C(\N)NC(=O)C=Cc1ccccc1.
What is the InChIKey of N-(N'-ethylcarbamimidoyl)-3-phenylprop-2-enamide?
The InChIKey is KARVUJDEPRSAFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O/c1-2-14-12(13)15-11(16)9-8-10-6-4-3-5-7-10/h3-9H,2H2,1H3,(H3,13,14,15,16).
What are the key properties of N-(N'-ethylcarbamimidoyl)-3-phenylprop-2-enamide?
N-(N'-ethylcarbamimidoyl)-3-phenylprop-2-enamide has a molecular weight of 217.27 g/mol, XLogP of 1.15, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(N'-ethylcarbamimidoyl)-3-phenylprop-2-enamide is sourced from PubChem (CID 174544031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).