About 2-aminoacetonitrile;1H-indole
2-aminoacetonitrile;1H-indole (PubChem CID 174544164) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is 2-aminoacetonitrile;1H-indole.
Molecular Properties
| Compound Name | 2-aminoacetonitrile;1H-indole |
| PubChem CID | 174544164 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 2-aminoacetonitrile;1H-indole |
| SMILES | N#CCN.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C8H7N.C2H4N2/c1-2-4-8-7(3-1)5-6-9-8;3-1-2-4/h1-6,9H;1,3H2 |
| InChIKey | SKJQONNURSNZHH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoacetonitrile;1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetonitrile;1H-indole?
The IUPAC name of 2-aminoacetonitrile;1H-indole (CID 174544164) is 2-aminoacetonitrile;1H-indole.
What is the SMILES notation for 2-aminoacetonitrile;1H-indole?
The canonical SMILES for 2-aminoacetonitrile;1H-indole is N#CCN.c1ccc2[nH]ccc2c1.
What is the InChIKey of 2-aminoacetonitrile;1H-indole?
The InChIKey is SKJQONNURSNZHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N.C2H4N2/c1-2-4-8-7(3-1)5-6-9-8;3-1-2-4/h1-6,9H;1,3H2.
What are the key properties of 2-aminoacetonitrile;1H-indole?
2-aminoacetonitrile;1H-indole has a molecular weight of 173.22 g/mol, XLogP of 1.64, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetonitrile;1H-indole is sourced from PubChem (CID 174544164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).