C23H46O4Si3 — CID 174544234
2,4,6-tricyclohexyl-2-(1-propan-2-yloxyethyl)-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 174544234) has the molecular formula C23H46O4Si3 and a molecular weight of 470.88 g/mol. Its IUPAC name is 2,4,6-tricyclohexyl-2-(1-propan-2-yloxyethyl)-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,4,6-tricyclohexyl-2-(1-propan-2-yloxyethyl)-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 174544234 |
| Molecular Formula | C23H46O4Si3 |
| Molecular Weight | 470.88 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 2,4,6-tricyclohexyl-2-(1-propan-2-yloxyethyl)-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | CC(C)OC(C)[Si]1(C2CCCCC2)O[SiH](C2CCCCC2)O[SiH](C2CCCCC2)O1 |
| InChI | InChI=1S/C23H46O4Si3/c1-19(2)24-20(3)30(23-17-11-6-12-18-23)26-28(21-13-7-4-8-14-21)25-29(27-30)22-15-9-5-10-16-22/h19-23,28-29H,4-18H2,1-3H3 |
| InChIKey | IKFXAZOJOSBPOX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.88 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|