hydrogen sulfite;1,1,2,2-tetrafluoroethene

C2HF4O3S- — CID 174544729

IUPAChydrogen sulfite;1,1,2,2-tetrafluoroethene
SMILESFC(F)=C(F)F.O=S([O-])O
InChIInChI=1S/C2F4.H2O3S/c3-1(4)2(5)6;1-4(2)3/h;(H2,1,2,3)/p-1
InChIKeyNHXRZQNEICWSCX-UHFFFAOYSA-M
MW181.09 g/mol
LogP1.33
Rot. Bonds

About hydrogen sulfite;1,1,2,2-tetrafluoroethene

hydrogen sulfite;1,1,2,2-tetrafluoroethene (PubChem CID 174544729) has the molecular formula C2HF4O3S- and a molecular weight of 181.09 g/mol. Its IUPAC name is hydrogen sulfite;1,1,2,2-tetrafluoroethene.

Molecular Properties

Compound Namehydrogen sulfite;1,1,2,2-tetrafluoroethene
PubChem CID174544729
Molecular FormulaC2HF4O3S-
Molecular Weight181.09 g/mol
Exact Mass180.96
IUPAC Namehydrogen sulfite;1,1,2,2-tetrafluoroethene
SMILESFC(F)=C(F)F.O=S([O-])O
InChIInChI=1S/C2F4.H2O3S/c3-1(4)2(5)6;1-4(2)3/h;(H2,1,2,3)/p-1
InChIKeyNHXRZQNEICWSCX-UHFFFAOYSA-M
XLogP1.33
TPSA60.36 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.09
LogP ≤ 51.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze hydrogen sulfite;1,1,2,2-tetrafluoroethene with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of hydrogen sulfite;1,1,2,2-tetrafluoroethene?
The IUPAC name of hydrogen sulfite;1,1,2,2-tetrafluoroethene (CID 174544729) is hydrogen sulfite;1,1,2,2-tetrafluoroethene.
What is the SMILES notation for hydrogen sulfite;1,1,2,2-tetrafluoroethene?
The canonical SMILES for hydrogen sulfite;1,1,2,2-tetrafluoroethene is FC(F)=C(F)F.O=S([O-])O.
What is the InChIKey of hydrogen sulfite;1,1,2,2-tetrafluoroethene?
The InChIKey is NHXRZQNEICWSCX-UHFFFAOYSA-M. The full InChI is InChI=1S/C2F4.H2O3S/c3-1(4)2(5)6;1-4(2)3/h;(H2,1,2,3)/p-1.
What are the key properties of hydrogen sulfite;1,1,2,2-tetrafluoroethene?
hydrogen sulfite;1,1,2,2-tetrafluoroethene has a molecular weight of 181.09 g/mol, XLogP of 1.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfite;1,1,2,2-tetrafluoroethene is sourced from PubChem (CID 174544729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).