About potassium;(cyclohexylamino)sulfamic acid;hydride
potassium;(cyclohexylamino)sulfamic acid;hydride (PubChem CID 174544890) has the molecular formula C6H15KN2O3S
and a molecular weight of 234.36 g/mol. Its IUPAC name is potassium;(cyclohexylamino)sulfamic acid;hydride.
Molecular Properties
| Compound Name | potassium;(cyclohexylamino)sulfamic acid;hydride |
| PubChem CID | 174544890 |
| Molecular Formula | C6H15KN2O3S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | potassium;(cyclohexylamino)sulfamic acid;hydride |
| SMILES | O=S(=O)(O)NNC1CCCCC1.[H-].[K+] |
| InChI | InChI=1S/C6H14N2O3S.K.H/c9-12(10,11)8-7-6-4-2-1-3-5-6;;/h6-8H,1-5H2,(H,9,10,11);;/q;+1;-1 |
| InChIKey | FEZGYZWGXIKOAH-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;(cyclohexylamino)sulfamic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;(cyclohexylamino)sulfamic acid;hydride?
The IUPAC name of potassium;(cyclohexylamino)sulfamic acid;hydride (CID 174544890) is potassium;(cyclohexylamino)sulfamic acid;hydride.
What is the SMILES notation for potassium;(cyclohexylamino)sulfamic acid;hydride?
The canonical SMILES for potassium;(cyclohexylamino)sulfamic acid;hydride is O=S(=O)(O)NNC1CCCCC1.[H-].[K+].
What is the InChIKey of potassium;(cyclohexylamino)sulfamic acid;hydride?
The InChIKey is FEZGYZWGXIKOAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O3S.K.H/c9-12(10,11)8-7-6-4-2-1-3-5-6;;/h6-8H,1-5H2,(H,9,10,11);;/q;+1;-1.
What are the key properties of potassium;(cyclohexylamino)sulfamic acid;hydride?
potassium;(cyclohexylamino)sulfamic acid;hydride has a molecular weight of 234.36 g/mol, XLogP of -2.67, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;(cyclohexylamino)sulfamic acid;hydride is sourced from PubChem (CID 174544890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).