C11H7FN2O — CID 174545191
N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine (PubChem CID 174545191) has the molecular formula C11H7FN2O and a molecular weight of 202.19 g/mol. Its IUPAC name is N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine.
| Compound Name | N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine |
|---|---|
| PubChem CID | 174545191 |
| Molecular Formula | C11H7FN2O |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine |
| SMILES | Fc1ccc(Nc2nccc3c2O3)cc1 |
| InChI | InChI=1S/C11H7FN2O/c12-7-1-3-8(4-2-7)14-11-10-9(15-10)5-6-13-11/h1-6H,(H,13,14) |
| InChIKey | LNSIJLPCWVOALB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 37.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|