About N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine
N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine (PubChem CID 174545191) has the molecular formula C11H7FN2O
and a molecular weight of 202.19 g/mol. Its IUPAC name is N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine |
| PubChem CID | 174545191 |
| Molecular Formula | C11H7FN2O |
| Molecular Weight | 202.19 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine |
| SMILES | Fc1ccc(Nc2nccc3c2O3)cc1 |
| InChI | InChI=1S/C11H7FN2O/c12-7-1-3-8(4-2-7)14-11-10-9(15-10)5-6-13-11/h1-6H,(H,13,14) |
| InChIKey | LNSIJLPCWVOALB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 37.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.19 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine?
The IUPAC name of N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine (CID 174545191) is N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine.
What is the SMILES notation for N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine?
The canonical SMILES for N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine is Fc1ccc(Nc2nccc3c2O3)cc1.
What is the InChIKey of N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine?
The InChIKey is LNSIJLPCWVOALB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7FN2O/c12-7-1-3-8(4-2-7)14-11-10-9(15-10)5-6-13-11/h1-6H,(H,13,14).
What are the key properties of N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine?
N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine has a molecular weight of 202.19 g/mol, XLogP of 3.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-7-oxa-3-azabicyclo[4.1.0]hepta-1(6),2,4-trien-2-amine is sourced from PubChem (CID 174545191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).