About neodymium;(Z)-octadec-9-en-1-one
neodymium;(Z)-octadec-9-en-1-one (PubChem CID 174545292) has the molecular formula C18H33NdO-
and a molecular weight of 409.70 g/mol. Its IUPAC name is neodymium;(Z)-octadec-9-en-1-one.
Molecular Properties
| Compound Name | neodymium;(Z)-octadec-9-en-1-one |
| PubChem CID | 174545292 |
| Molecular Formula | C18H33NdO- |
| Molecular Weight | 409.70 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | neodymium;(Z)-octadec-9-en-1-one |
| SMILES | CCCCCCCC/C=C\CCCCCCC[C-]=O.[Nd] |
| InChI | InChI=1S/C18H33O.Nd/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;/h9-10H,2-8,11-17H2,1H3;/q-1;/b10-9-; |
| InChIKey | IAMQLZVDHOKVSR-KVVVOXFISA-N |
| XLogP | 6.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.70 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze neodymium;(Z)-octadec-9-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of neodymium;(Z)-octadec-9-en-1-one?
The IUPAC name of neodymium;(Z)-octadec-9-en-1-one (CID 174545292) is neodymium;(Z)-octadec-9-en-1-one.
What is the SMILES notation for neodymium;(Z)-octadec-9-en-1-one?
The canonical SMILES for neodymium;(Z)-octadec-9-en-1-one is CCCCCCCC/C=C\CCCCCCC[C-]=O.[Nd].
What is the InChIKey of neodymium;(Z)-octadec-9-en-1-one?
The InChIKey is IAMQLZVDHOKVSR-KVVVOXFISA-N. The full InChI is InChI=1S/C18H33O.Nd/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;/h9-10H,2-8,11-17H2,1H3;/q-1;/b10-9-;.
What are the key properties of neodymium;(Z)-octadec-9-en-1-one?
neodymium;(Z)-octadec-9-en-1-one has a molecular weight of 409.70 g/mol, XLogP of 6.13, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for neodymium;(Z)-octadec-9-en-1-one is sourced from PubChem (CID 174545292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).