About 1-(2-hexanoyl-4-methylphenyl)-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea
1-(2-hexanoyl-4-methylphenyl)-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea (PubChem CID 174545502) has the molecular formula C18H23N3O4S2
and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-(2-hexanoyl-4-methylphenyl)-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-(2-hexanoyl-4-methylphenyl)-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea |
| PubChem CID | 174545502 |
| Molecular Formula | C18H23N3O4S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 1-(2-hexanoyl-4-methylphenyl)-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea |
| SMILES | CCCCCC(=O)c1cc(C)ccc1NC(=O)Nc1ncc(S(C)(=O)=O)s1 |
| InChI | InChI=1S/C18H23N3O4S2/c1-4-5-6-7-15(22)13-10-12(2)8-9-14(13)20-17(23)21-18-19-11-16(26-18)27(3,24)25/h8-11H,4-7H2,1-3H3,(H2,19,20,21,23) |
| InChIKey | KNWHTXALEWSUHU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hexanoyl-4-methylphenyl)-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hexanoyl-4-methylphenyl)-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea?
The IUPAC name of 1-(2-hexanoyl-4-methylphenyl)-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea (CID 174545502) is 1-(2-hexanoyl-4-methylphenyl)-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-(2-hexanoyl-4-methylphenyl)-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-(2-hexanoyl-4-methylphenyl)-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea is CCCCCC(=O)c1cc(C)ccc1NC(=O)Nc1ncc(S(C)(=O)=O)s1.
What is the InChIKey of 1-(2-hexanoyl-4-methylphenyl)-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea?
The InChIKey is KNWHTXALEWSUHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O4S2/c1-4-5-6-7-15(22)13-10-12(2)8-9-14(13)20-17(23)21-18-19-11-16(26-18)27(3,24)25/h8-11H,4-7H2,1-3H3,(H2,19,20,21,23).
What are the key properties of 1-(2-hexanoyl-4-methylphenyl)-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea?
1-(2-hexanoyl-4-methylphenyl)-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea has a molecular weight of 409.53 g/mol, XLogP of 4.26, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hexanoyl-4-methylphenyl)-3-(5-methylsulfonyl-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 174545502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).