About ethene;pyrrolidine-2,3-dione
ethene;pyrrolidine-2,3-dione (PubChem CID 174546175) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is ethene;pyrrolidine-2,3-dione.
Molecular Properties
| Compound Name | ethene;pyrrolidine-2,3-dione |
| PubChem CID | 174546175 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | ethene;pyrrolidine-2,3-dione |
| SMILES | C=C.O=C1CCNC1=O |
| InChI | InChI=1S/C4H5NO2.C2H4/c6-3-1-2-5-4(3)7;1-2/h1-2H2,(H,5,7);1-2H2 |
| InChIKey | MSIGULYADCQFRU-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;pyrrolidine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;pyrrolidine-2,3-dione?
The IUPAC name of ethene;pyrrolidine-2,3-dione (CID 174546175) is ethene;pyrrolidine-2,3-dione.
What is the SMILES notation for ethene;pyrrolidine-2,3-dione?
The canonical SMILES for ethene;pyrrolidine-2,3-dione is C=C.O=C1CCNC1=O.
What is the InChIKey of ethene;pyrrolidine-2,3-dione?
The InChIKey is MSIGULYADCQFRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.C2H4/c6-3-1-2-5-4(3)7;1-2/h1-2H2,(H,5,7);1-2H2.
What are the key properties of ethene;pyrrolidine-2,3-dione?
ethene;pyrrolidine-2,3-dione has a molecular weight of 127.14 g/mol, XLogP of -0.12, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;pyrrolidine-2,3-dione is sourced from PubChem (CID 174546175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).