C26H25ClN2O3 — CID 174546595
1-benzyl-4-[2-(4-chlorophenoxy)acetyl]-3-phenylpiperazine-2-carbaldehyde (PubChem CID 174546595) has the molecular formula C26H25ClN2O3 and a molecular weight of 448.95 g/mol. Its IUPAC name is 1-benzyl-4-[2-(4-chlorophenoxy)acetyl]-3-phenylpiperazine-2-carbaldehyde.
| Compound Name | 1-benzyl-4-[2-(4-chlorophenoxy)acetyl]-3-phenylpiperazine-2-carbaldehyde |
|---|---|
| PubChem CID | 174546595 |
| Molecular Formula | C26H25ClN2O3 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 1-benzyl-4-[2-(4-chlorophenoxy)acetyl]-3-phenylpiperazine-2-carbaldehyde |
| SMILES | O=CC1C(c2ccccc2)N(C(=O)COc2ccc(Cl)cc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C26H25ClN2O3/c27-22-11-13-23(14-12-22)32-19-25(31)29-16-15-28(17-20-7-3-1-4-8-20)24(18-30)26(29)21-9-5-2-6-10-21/h1-14,18,24,26H,15-17,19H2 |
| InChIKey | JKDTWEHUFVHNBD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|